CAS 2764889-44-1 is the registry number for 5-Bromo-6-(tert-butyl)-4-methoxythieno[2,3-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-tert-butyl-4-methoxythieno[2,3-d]pyrimidine (CAS 2764889-44-1) is a chemical compound with the molecular formula C11H13BrN2OS and a molecular weight of 301.20 g/mol. IUPAC name: 5-bromo-6-tert-butyl-4-methoxythieno[2,3-d]pyrimidine. InChIKey: FABGRPNYLBBMNY-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2OS |
|---|---|
| Molecular weight | 301.20 g/mol |
| IUPAC name | 5-bromo-6-tert-butyl-4-methoxythieno[2,3-d]pyrimidine |
| InChIKey | FABGRPNYLBBMNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C2=C(N=CN=C2S1)OC)Br |
Computed by PubChem (NCBI)