CAS 4335-26-6 is the registry number for 2-(2-Imino-1,3-thiazolidin-3-yl)-1-phenylethanone hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide (CAS 4335-26-6) is a chemical compound with the molecular formula C11H13BrN2OS and a molecular weight of 301.20 g/mol. IUPAC name: 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide. InChIKey: HLACPNZZRMLNQK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2OS |
|---|---|
| Molecular weight | 301.20 g/mol |
| IUPAC name | 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide |
| InChIKey | HLACPNZZRMLNQK-UHFFFAOYSA-N |
| SMILES | C1CSC(=N)N1CC(=O)C2=CC=CC=C2.Br |
Computed by PubChem (NCBI)