Products 2765218-28-6
CAS 2765218-28-6 appears in our catalog under these names: Angiogenesis agent 1, Angiogenesis agent 1, 99.39%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 5 mg, 10mM/1mL, 100 mg, 10 mg.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[3-[(4-methoxyphenyl)methyl]phenoxy]oxane-3,4,5-triol (CAS 2765218-28-6) is a chemical compound with the molecular formula C20H24O7 and a molecular weight of 376.4 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[3-[(4-methoxyphenyl)methyl]phenoxy]oxane-3,4,5-triol. InChIKey: UUJGQDYRNYTUFA-OUUBHVDSSA-N.
| Molecular formula | C20H24O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[3-[(4-methoxyphenyl)methyl]phenoxy]oxane-3,4,5-triol |
| InChIKey | UUJGQDYRNYTUFA-OUUBHVDSSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=CC(=CC=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Angiogenesis agent 1, Angiogenesis agent C-30