Products 2765618-23-1
CAS 2765618-23-1 is the registry number for Methyl 5-acetyl-2-hydroxy-3-((phenylsulfonyl)methyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-acetyl-3-(benzenesulfonylmethyl)-2-hydroxybenzoate (CAS 2765618-23-1) is a chemical compound with the molecular formula C17H16O6S and a molecular weight of 348.4 g/mol. IUPAC name: methyl 5-acetyl-3-(benzenesulfonylmethyl)-2-hydroxybenzoate. InChIKey: IHLUFYSUTHERLV-UHFFFAOYSA-N.
| Molecular formula | C17H16O6S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | methyl 5-acetyl-3-(benzenesulfonylmethyl)-2-hydroxybenzoate |
| InChIKey | IHLUFYSUTHERLV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)C(=O)OC)O)CS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)