CAS 823788-14-3 is the registry number for (2E)-3-{3-Methoxy-4-((4-methylbenzenesulfonyl)oxy)phenyl}prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
(E)-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid (CAS 823788-14-3) is a chemical compound with the molecular formula C17H16O6S and a molecular weight of 348.4 g/mol. IUPAC name: (E)-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid. InChIKey: OBIOXFLUCOHLTL-UXBLZVDNSA-N.
| Molecular formula | C17H16O6S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (E)-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid |
| InChIKey | OBIOXFLUCOHLTL-UXBLZVDNSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=C(C=C(C=C2)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)