CAS 2766301-37-3 is the registry number for 4-Chloro-6-(2,6-dimethylphenyl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-(2,6-dimethylphenyl)pyridin-2-amine (CAS 2766301-37-3) is a chemical compound with the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. IUPAC name: 4-chloro-6-(2,6-dimethylphenyl)pyridin-2-amine. InChIKey: KPDPXFUTYXYGEY-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2 |
|---|---|
| Molecular weight | 232.71 g/mol |
| IUPAC name | 4-chloro-6-(2,6-dimethylphenyl)pyridin-2-amine |
| InChIKey | KPDPXFUTYXYGEY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=NC(=CC(=C2)Cl)N |
Computed by PubChem (NCBI)