Products 58413-02-8
CAS 58413-02-8 is the registry number for 3-(4-Chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole (CAS 58413-02-8) is a chemical compound with the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. IUPAC name: 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole. InChIKey: KVEOBXMMMLVLKY-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2 |
|---|---|
| Molecular weight | 232.71 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole |
| InChIKey | KVEOBXMMMLVLKY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)