CAS 276670-60-1 is the registry number for 5'-Amino-2,3'-bithiophene-4'-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-4-thiophen-2-ylthiophene-3-carbonitrile (CAS 276670-60-1) is a chemical compound with the molecular formula C9H6N2S2 and a molecular weight of 206.3 g/mol. IUPAC name: 2-amino-4-thiophen-2-ylthiophene-3-carbonitrile. InChIKey: OMMDPTFXYBRCBW-UHFFFAOYSA-N.
| Molecular formula | C9H6N2S2 |
|---|---|
| Molecular weight | 206.3 g/mol |
| IUPAC name | 2-amino-4-thiophen-2-ylthiophene-3-carbonitrile |
| InChIKey | OMMDPTFXYBRCBW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CSC(=C2C#N)N |
Computed by PubChem (NCBI)