CAS 6649-72-5 is the registry number for 6-(Thiophen-2-yl)imidazo[2,1-b]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole (CAS 6649-72-5) is a chemical compound with the molecular formula C9H6N2S2 and a molecular weight of 206.3 g/mol. IUPAC name: 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole. InChIKey: YKINBJCTANWRJC-UHFFFAOYSA-N.
| Molecular formula | C9H6N2S2 |
|---|---|
| Molecular weight | 206.3 g/mol |
| IUPAC name | 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole |
| InChIKey | YKINBJCTANWRJC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CN3C=CSC3=N2 |
Computed by PubChem (NCBI)