CAS 2767008-08-0 is the registry number for Methyl (2S,3S)-2-methyl-3-(3-methylpyridin-2-yl)butanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3S)-2-methyl-3-(3-methyl-2-pyridinyl)butanoate (CAS 2767008-08-0) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: methyl (2S,3S)-2-methyl-3-(3-methyl-2-pyridinyl)butanoate. InChIKey: YDWNTAHITPGUTL-UWVGGRQHSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | methyl (2S,3S)-2-methyl-3-(3-methyl-2-pyridinyl)butanoate |
| InChIKey | YDWNTAHITPGUTL-UWVGGRQHSA-N |
| SMILES | CC1=C(N=CC=C1)[C@@H](C)[C@H](C)C(=O)OC |
Computed by PubChem (NCBI)