Products 276702-53-5

CAS 276702-53-5 appears in our catalog under these names: 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride, 95%, 2,6–Dichloro–3–nitrobenzene–1–sulfonyl chloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2,6-dichloro-3-nitrobenzenesulfonyl chloride (CAS 276702-53-5) is a chemical compound with the molecular formula C6H2Cl3NO4S and a molecular weight of 290.5 g/mol. IUPAC name: 2,6-dichloro-3-nitrobenzenesulfonyl chloride. InChIKey: KMRQWMSLMFLCKC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl3NO4S
Molecular weight290.5 g/mol
IUPAC name2,6-dichloro-3-nitrobenzenesulfonyl chloride
InChIKeyKMRQWMSLMFLCKC-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)