Products 568586-12-9

CAS 568586-12-9 appears in our catalog under these names: 2,4-Dichloro-6-nitrobenzene-1-sulfonyl chloride, 95%, 2,4-Dichloro-6-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.

2,4-dichloro-6-nitrobenzenesulfonyl chloride (CAS 568586-12-9) is a chemical compound with the molecular formula C6H2Cl3NO4S and a molecular weight of 290.5 g/mol. IUPAC name: 2,4-dichloro-6-nitrobenzenesulfonyl chloride. InChIKey: MCZHNTYAIXGENI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl3NO4S
Molecular weight290.5 g/mol
IUPAC name2,4-dichloro-6-nitrobenzenesulfonyl chloride
InChIKeyMCZHNTYAIXGENI-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1[N+](=O)[O-])S(=O)(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)