Products 2767324-34-3

CAS 2767324-34-3 is the registry number for DDL-218, 99.49%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 10 mg, 50 mg, 10mM/1mL, 25 mg.

Structural formula: {0} (CAS {1})

(2-methyl-1-pyridin-4-ylpropan-2-yl) (2S)-2-aminopropanoate (CAS 2767324-34-3) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: (2-methyl-1-pyridin-4-ylpropan-2-yl) (2S)-2-aminopropanoate. InChIKey: GUVUAQXQYPLKMD-VIFPVBQESA-N.

Identity
Molecular formulaC12H18N2O2
Molecular weight222.28 g/mol
IUPAC name(2-methyl-1-pyridin-4-ylpropan-2-yl) (2S)-2-aminopropanoate
InChIKeyGUVUAQXQYPLKMD-VIFPVBQESA-N
SMILESC[C@@H](C(=O)OC(C)(C)CC1=CC=NC=C1)N

Computed by PubChem (NCBI)

Synonyms: orb3027928