CAS 2767324-34-3 is the registry number for DDL-218, 99.49%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 10 mg, 50 mg, 10mM/1mL, 25 mg.
(2-methyl-1-pyridin-4-ylpropan-2-yl) (2S)-2-aminopropanoate (CAS 2767324-34-3) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: (2-methyl-1-pyridin-4-ylpropan-2-yl) (2S)-2-aminopropanoate. InChIKey: GUVUAQXQYPLKMD-VIFPVBQESA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | (2-methyl-1-pyridin-4-ylpropan-2-yl) (2S)-2-aminopropanoate |
| InChIKey | GUVUAQXQYPLKMD-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)OC(C)(C)CC1=CC=NC=C1)N |
Computed by PubChem (NCBI)