CAS 2768-56-1 appears in our catalog under these names: Z–DL–Ser–OH, N-Carbobenzoxy-DL-serine, >98.0%(T), Cbz-DL-Ser-OH 97%, N-Cbz-DL-serine, 97%, 97%, 2-(((Benzyloxy)carbonyl)amino)-3-hydroxypropanoic acid, 99.29%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 500g, 10g, 1g, 5g, 1000g, 500 g.
3-hydroxy-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 2768-56-1) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: 3-hydroxy-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: GNIDSOFZAKMQAO-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 3-hydroxy-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | GNIDSOFZAKMQAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CO)C(=O)O |
Computed by PubChem (NCBI)