CAS 276861-64-4 appears in our catalog under these names: 3-Methoxy-4-(trifluoromethyl)benzyl alcohol, 97%, (3-Methoxy-4-(trifluoromethyl)phenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 10g, 5g.
[3-methoxy-4-(trifluoromethyl)phenyl]methanol (CAS 276861-64-4) is a chemical compound with the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. IUPAC name: [3-methoxy-4-(trifluoromethyl)phenyl]methanol. InChIKey: KGRHSPHJFOSYLA-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | [3-methoxy-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | KGRHSPHJFOSYLA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CO)C(F)(F)F |
Computed by PubChem (NCBI)