Products 2768663-14-3
CAS 2768663-14-3 appears in our catalog under these names: SN40, 99.26%, SN40, 99%, (2S,4S)-4-(([1,1'-Biphenyl]-4-ylmethyl)amino)pyrrolidine-2-carboxylic acid, 99%. Offered by: MedChemExpress, Chemat, BLDpharm. Available pack sizes: 100 mg, 25 mg, 5 mg, 10 mg, 50 mg, 1mg, 5mg, 10mg.
(2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid (CAS 2768663-14-3) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid. InChIKey: FKDKNHWXEJUEMP-IRXDYDNUSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid |
| InChIKey | FKDKNHWXEJUEMP-IRXDYDNUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)NCC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)