CAS 2768871-01-6 is the registry number for (6R,8R)-2,4-Dichloro-3,7,7-trimethyl-5,6,7,8-tetrahydro-6,8-methanoquinoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,9R)-4,6-dichloro-5,10,10-trimethyl-3-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene (CAS 2768871-01-6) is a chemical compound with the molecular formula C13H15Cl2N and a molecular weight of 256.17 g/mol. IUPAC name: (1R,9R)-4,6-dichloro-5,10,10-trimethyl-3-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene. InChIKey: QEBMIHBMLZNIPX-CBAPKCEASA-N.
| Molecular formula | C13H15Cl2N |
|---|---|
| Molecular weight | 256.17 g/mol |
| IUPAC name | (1R,9R)-4,6-dichloro-5,10,10-trimethyl-3-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
| InChIKey | QEBMIHBMLZNIPX-CBAPKCEASA-N |
| SMILES | CC1=C(C2=C([C@@H]3C[C@H](C2)C3(C)C)N=C1Cl)Cl |
Computed by PubChem (NCBI)