Products 59905-71-4
CAS 59905-71-4 is the registry number for Org 6582. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,9S,13R)-5-chlorotricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-13-amine;hydrochloride (CAS 59905-71-4) is a chemical compound with the molecular formula C13H15Cl2N and a molecular weight of 256.17 g/mol. IUPAC name: (1S,9S,13R)-5-chlorotricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-13-amine;hydrochloride. InChIKey: LWRJZIPAGMGXQJ-POJHVLMBSA-N.
| Molecular formula | C13H15Cl2N |
|---|---|
| Molecular weight | 256.17 g/mol |
| IUPAC name | (1S,9S,13R)-5-chlorotricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-13-amine;hydrochloride |
| InChIKey | LWRJZIPAGMGXQJ-POJHVLMBSA-N |
| SMILES | C1C=C[C@@H]2CC3=C([C@H]1[C@@H]2N)C=CC(=C3)Cl.Cl |
Computed by PubChem (NCBI)