CAS 276890-09-6 appears in our catalog under these names: 6-tert-Butyl-2,3-dihydro-1H-inden-1-ol, 95%, 6-tert-Butyl-2,3-dihydro-1H-inden-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-tert-butyl-2,3-dihydro-1H-inden-1-ol (CAS 276890-09-6) is a chemical compound with the molecular formula C13H18O and a molecular weight of 190.28 g/mol. IUPAC name: 6-tert-butyl-2,3-dihydro-1H-inden-1-ol. InChIKey: ZFVNKELWXMPTGU-UHFFFAOYSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 6-tert-butyl-2,3-dihydro-1H-inden-1-ol |
| InChIKey | ZFVNKELWXMPTGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(CCC2O)C=C1 |
Computed by PubChem (NCBI)