CAS 2769112-83-4 is the registry number for (3S,4R)-4-((tert-Butyldiphenylsilyl)oxy)tetrahydrofuran-3-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-ol (CAS 2769112-83-4) is a chemical compound with the molecular formula C20H26O3Si and a molecular weight of 342.5 g/mol. IUPAC name: (3S,4R)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-ol. InChIKey: GCISAPIYHYACDR-RBUKOAKNSA-N.
| Molecular formula | C20H26O3Si |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | (3S,4R)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-ol |
| InChIKey | GCISAPIYHYACDR-RBUKOAKNSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[C@@H]3COC[C@@H]3O |
Computed by PubChem (NCBI)