Products 330798-54-4
CAS 330798-54-4 is the registry number for 3-[(tert-Butyldiphenylsilyl)oxy]butanoic Acid, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[tert-butyl(diphenyl)silyl]oxybutanoic acid (CAS 330798-54-4) is a chemical compound with the molecular formula C20H26O3Si and a molecular weight of 342.5 g/mol. IUPAC name: 3-[tert-butyl(diphenyl)silyl]oxybutanoic acid. InChIKey: YTLLZVITAFKZAP-UHFFFAOYSA-N.
| Molecular formula | C20H26O3Si |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 3-[tert-butyl(diphenyl)silyl]oxybutanoic acid |
| InChIKey | YTLLZVITAFKZAP-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C(C)(C)C |
Computed by PubChem (NCBI)