CAS 27696-01-1 appears in our catalog under these names: N-Benzoyl-DL-threonine, N-Benzoyl-L-threonine, 95+%. Offered by: TRC, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
(2S,3R)-2-benzamido-3-hydroxybutanoic acid (CAS 27696-01-1) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2S,3R)-2-benzamido-3-hydroxybutanoic acid. InChIKey: IOQIWWTVXOPYQR-APPZFPTMSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2S,3R)-2-benzamido-3-hydroxybutanoic acid |
| InChIKey | IOQIWWTVXOPYQR-APPZFPTMSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)C1=CC=CC=C1)O |
Computed by PubChem (NCBI)