Products 2770104-92-0
CAS 2770104-92-0 is the registry number for Vps34-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,6S)-11-[(3R)-3-methylmorpholin-4-yl]-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one (CAS 2770104-92-0) is a chemical compound with the molecular formula C14H20N4O2 and a molecular weight of 276.33 g/mol. IUPAC name: (2R,6S)-11-[(3R)-3-methylmorpholin-4-yl]-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one. InChIKey: LQBRZKIUSVUXJP-OUAUKWLOSA-N.
| Molecular formula | C14H20N4O2 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | (2R,6S)-11-[(3R)-3-methylmorpholin-4-yl]-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-dien-8-one |
| InChIKey | LQBRZKIUSVUXJP-OUAUKWLOSA-N |
| SMILES | C[C@@H]1COCCN1C2=NN3[C@@H]4CCC[C@@H]4NC(=O)C3=C2 |
Computed by PubChem (NCBI)
Synonyms:
Vps34-IN-3, compound 5 [PMID: 34779204]