Products 2770244-32-9
CAS 2770244-32-9 is the registry number for N-Butyl molnupiravir. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl butanoate (CAS 2770244-32-9) is a chemical compound with the molecular formula C13H19N3O7 and a molecular weight of 329.31 g/mol. IUPAC name: [(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl butanoate. InChIKey: UFRPBGZCTRKUTJ-FAQVLOEFSA-N.
| Molecular formula | C13H19N3O7 |
|---|---|
| Molecular weight | 329.31 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl butanoate |
| InChIKey | UFRPBGZCTRKUTJ-FAQVLOEFSA-N |
| SMILES | CCCC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)NO)O)O |
Computed by PubChem (NCBI)
Synonyms:
Molnupiravir Impurity 20, orb3180079