Products 42002-18-6
CAS 42002-18-6 appears in our catalog under these names: Boc-asn-osu, 95%, Boc–Asn–OSu. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 25g, 5g.
(2,5-dioxopyrrolidin-1-yl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 42002-18-6) is a chemical compound with the molecular formula C13H19N3O7 and a molecular weight of 329.31 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: OVQPXDHWGIUBIA-ZETCQYMHSA-N.
| Molecular formula | C13H19N3O7 |
|---|---|
| Molecular weight | 329.31 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | OVQPXDHWGIUBIA-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)