Products 2770456-61-4
CAS 2770456-61-4 is the registry number for 4-Chloro-3-[[4-[[(3S)-tetrahydro-3-furanyl]oxy]phenyl]methyl]phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenol (CAS 2770456-61-4) is a chemical compound with the molecular formula C17H17ClO3 and a molecular weight of 304.8 g/mol. IUPAC name: 4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenol. InChIKey: SSWRXTPXZOULOF-INIZCTEOSA-N.
| Molecular formula | C17H17ClO3 |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | 4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenol |
| InChIKey | SSWRXTPXZOULOF-INIZCTEOSA-N |
| SMILES | C1COC[C@H]1OC2=CC=C(C=C2)CC3=C(C=CC(=C3)O)Cl |
Computed by PubChem (NCBI)