Products 2770486-52-5
CAS 2770486-52-5 is the registry number for tert-butyl 3-cyano-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-cyano-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate (CAS 2770486-52-5) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: tert-butyl 3-cyano-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate. InChIKey: GZYJTBWIGQHACA-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | tert-butyl 3-cyano-3-(2-methoxy-2-oxoethyl)azetidine-1-carboxylate |
| InChIKey | GZYJTBWIGQHACA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CC(=O)OC)C#N |
Computed by PubChem (NCBI)