Products 2771307-60-7
CAS 2771307-60-7 is the registry number for Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate fumarate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Benzyl (2S)-2-(cyanomethyl)piperazine-1-carboxylate;(E)-but-2-enedioic acid (CAS 2771307-60-7) is a chemical compound with the molecular formula C18H21N3O6 and a molecular weight of 375.4 g/mol. IUPAC name: benzyl (2S)-2-(cyanomethyl)piperazine-1-carboxylate;(E)-but-2-enedioic acid. InChIKey: KFNVJHRUNNVIHP-QDSMGTAFSA-N.
| Molecular formula | C18H21N3O6 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | benzyl (2S)-2-(cyanomethyl)piperazine-1-carboxylate;(E)-but-2-enedioic acid |
| InChIKey | KFNVJHRUNNVIHP-QDSMGTAFSA-N |
| SMILES | C1CN([C@H](CN1)CC#N)C(=O)OCC2=CC=CC=C2.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)