CAS 64183-66-0 is the registry number for 1-Deazariboflavin. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 10mg, 5mg, 25mg.
7,8-dimethyl-5-(2,3,4,5-tetrahydroxypentyl)pyrido[4,3-b]quinoxaline-1,3-dione (CAS 64183-66-0) is a chemical compound with the molecular formula C18H21N3O6 and a molecular weight of 375.4 g/mol. IUPAC name: 7,8-dimethyl-5-(2,3,4,5-tetrahydroxypentyl)pyrido[4,3-b]quinoxaline-1,3-dione. InChIKey: VVSMAKSRHMDDGV-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O6 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 7,8-dimethyl-5-(2,3,4,5-tetrahydroxypentyl)pyrido[4,3-b]quinoxaline-1,3-dione |
| InChIKey | VVSMAKSRHMDDGV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C3=CC(=O)NC(=O)C3=N2)CC(C(C(CO)O)O)O |
Computed by PubChem (NCBI)