Products 19342-73-5
CAS 19342-73-5 appears in our catalog under these names: 5-Deazariboflavin, 5-Deazariboflavin, >95% (HPLC). Offered by: Biosynth, TRC. Available pack sizes: 25mg, 10mg, 50mg, 100mg.
7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]pyrimido[4,5-b]quinoline-2,4-dione (CAS 19342-73-5) is a chemical compound with the molecular formula C18H21N3O6 and a molecular weight of 375.4 g/mol. IUPAC name: 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]pyrimido[4,5-b]quinoline-2,4-dione. InChIKey: XHELUUHUHSGXOC-ZNMIVQPWSA-N.
| Molecular formula | C18H21N3O6 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]pyrimido[4,5-b]quinoline-2,4-dione |
| InChIKey | XHELUUHUHSGXOC-ZNMIVQPWSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=C2)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Deazariboflavin, 5-Carbariboflavin