Products 2772354-76-2
CAS 2772354-76-2 is the registry number for 3,5 Dimethoxy-2,4-bis(1-methylethyl)benzoic Acid. Offered by: TRC. Available pack sizes: 1g.
3,5-dimethoxy-2,4-di(propan-2-yl)benzoic acid (CAS 2772354-76-2) is a chemical compound with the molecular formula C15H22O4 and a molecular weight of 266.33 g/mol. IUPAC name: 3,5-dimethoxy-2,4-di(propan-2-yl)benzoic acid. InChIKey: KSBCJAUOKQQTDY-UHFFFAOYSA-N.
| Molecular formula | C15H22O4 |
|---|---|
| Molecular weight | 266.33 g/mol |
| IUPAC name | 3,5-dimethoxy-2,4-di(propan-2-yl)benzoic acid |
| InChIKey | KSBCJAUOKQQTDY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1C(=O)O)OC)C(C)C)OC |
Computed by PubChem (NCBI)