CAS 567-75-9 appears in our catalog under these names: Leptospermone, Leptospermone, 98.46%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 25 mg, 5 mg, 50 mg, 10 mg.
2,2,4,4-tetramethyl-6-(3-methylbutanoyl)cyclohexane-1,3,5-trione (CAS 567-75-9) is a chemical compound with the molecular formula C15H22O4 and a molecular weight of 266.33 g/mol. IUPAC name: 2,2,4,4-tetramethyl-6-(3-methylbutanoyl)cyclohexane-1,3,5-trione. InChIKey: YDWYMAHAWHBPPT-UHFFFAOYSA-N.
| Molecular formula | C15H22O4 |
|---|---|
| Molecular weight | 266.33 g/mol |
| IUPAC name | 2,2,4,4-tetramethyl-6-(3-methylbutanoyl)cyclohexane-1,3,5-trione |
| InChIKey | YDWYMAHAWHBPPT-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1C(=O)C(C(=O)C(C1=O)(C)C)(C)C |
Computed by PubChem (NCBI)