CAS 27724-96-5 appears in our catalog under these names: Cetraxate hydrochloride, Cetraxate, hydrochloride, 95%, Cetraxate, Hydrochloride, Cetraxate hydrochloride/ 98.23% (existing batch purity), Cetraxate HCl - Bio-X â„¢. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, 250mg, 1g, 10mg, 25mg, 50mg, 100mg, 5g.
3-[4-[4-(aminomethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid;hydrochloride (CAS 27724-96-5) is a chemical compound with the molecular formula C17H24ClNO4 and a molecular weight of 341.8 g/mol. IUPAC name: 3-[4-[4-(aminomethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid;hydrochloride. InChIKey: USROQQUKEBHOFF-UHFFFAOYSA-N.
| Molecular formula | C17H24ClNO4 |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | 3-[4-[4-(aminomethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid;hydrochloride |
| InChIKey | USROQQUKEBHOFF-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CN)C(=O)OC2=CC=C(C=C2)CCC(=O)O.Cl |
Computed by PubChem (NCBI)