Products 4574-60-1
CAS 4574-60-1 appears in our catalog under these names: Atropine-N-oxide Hydrochloride, >95% (HPLC), Atropine N-Oxide Hydrochloride, Atropine oxide (hydrochloride), Atropine-N-oxide hydrochloride. Offered by: TRC, Mikromol, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 500mg, 50mg, 25mg, 25 mg, 50 mg, 5 mg, 100 mg.
[(1S,5R)-8-methyl-8-oxido-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;hydrochloride (CAS 4574-60-1) is a chemical compound with the molecular formula C17H24ClNO4 and a molecular weight of 341.8 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-oxido-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;hydrochloride. InChIKey: QTRBWTMEQQSFLO-ICPLZUBISA-N.
| Molecular formula | C17H24ClNO4 |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-oxido-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;hydrochloride |
| InChIKey | QTRBWTMEQQSFLO-ICPLZUBISA-N |
| SMILES | C[N+]1([C@@H]2CC[C@H]1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)[O-].Cl |
Computed by PubChem (NCBI)
Synonyms:
ATROPINE OXIDE HYDROCHLORIDE, Atropine-N-oxide hydrochloride, Atropine N-oxide hydrochloride, Atropine Oxide HCl, Atropine Oxide Hydrochloride [USAN], AMINOXYTROPINE TROPATE HYDROCHLORIDE, Atropine oxide hydrochloride (USAN), (endo, anti)-Atropine-N-oxide Hydrochloride, Prestwick_83, 4574-60-1 (HCl)