Products 27732-42-9
CAS 27732-42-9 is the registry number for Poly(styrene-d8). Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 2g.
1,2,3,4,5-pentadeuterio-6-(1,2,2-trideuterioethenyl)benzene (CAS 27732-42-9) is a chemical compound with the molecular formula C8H8 and a molecular weight of 112.20 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(1,2,2-trideuterioethenyl)benzene. InChIKey: PPBRXRYQALVLMV-GDALLCCDSA-N.
| Molecular formula | C8H8 |
|---|---|
| Molecular weight | 112.20 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(1,2,2-trideuterioethenyl)benzene |
| InChIKey | PPBRXRYQALVLMV-GDALLCCDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=C([2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
(2H8)Styrene, Benzene-d5, ethenyl-d3-, Benzene-1,2,3,4,5-d5, 6-(ethenyl-1,2,2-d3)-, Styrene-d8, Styrene D8, 1,2,3,4,5-pentadeuterio-6-(1,2,2-trideuterioethenyl)benzene, Styrene-d8 (Stabilized with Hydroquinone), 1,2,3,4,5-pentadeuterio-6-(1,2,2-trideuteriovinyl)benzene, Styrene-d8, stab., Poly(styrene)-styrene-d