Products 934-85-0

CAS 934-85-0 appears in our catalog under these names: Styrene-beta,beta-d2, 98 atom % D, min 98% Chemical Purity, STYRENE-BETA,BETA-D2, >=98 ATOM % D, >=&. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

2,2-dideuterioethenylbenzene (CAS 934-85-0) is a chemical compound with the molecular formula C8H8 and a molecular weight of 106.16 g/mol. IUPAC name: 2,2-dideuterioethenylbenzene. InChIKey: PPBRXRYQALVLMV-DICFDUPASA-N.

Identity
Molecular formulaC8H8
Molecular weight106.16 g/mol
IUPAC name2,2-dideuterioethenylbenzene
InChIKeyPPBRXRYQALVLMV-DICFDUPASA-N
SMILES[2H]C(=CC1=CC=CC=C1)[2H]

Computed by PubChem (NCBI)