CAS 2773477-77-1 is the registry number for 5-(1-(Methylsulfonyl)cyclopropyl)-1,3,4-oxadiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylic acid (CAS 2773477-77-1) is a chemical compound with the molecular formula C7H8N2O5S and a molecular weight of 232.22 g/mol. IUPAC name: 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylic acid. InChIKey: WXGWNFXYNYEDJU-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O5S |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylic acid |
| InChIKey | WXGWNFXYNYEDJU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1(CC1)C2=NN=C(O2)C(=O)O |
Computed by PubChem (NCBI)