CAS 746630-16-0 appears in our catalog under these names: 2-Methoxy-4-nitrobenzene-1-sulfonamide, 95%, 2-Methoxy-4-nitrobenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-methoxy-4-nitrobenzenesulfonamide (CAS 746630-16-0) is a chemical compound with the molecular formula C7H8N2O5S and a molecular weight of 232.22 g/mol. IUPAC name: 2-methoxy-4-nitrobenzenesulfonamide. InChIKey: IDPBJHBJQTTZKI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O5S |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 2-methoxy-4-nitrobenzenesulfonamide |
| InChIKey | IDPBJHBJQTTZKI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)