Products 2773490-60-9
CAS 2773490-60-9 is the registry number for Rel-tert-butyl (3R,4S)-4-(3-ethynylazetidin-1-yl)-3-hydroxypiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4S)-4-(3-ethynylazetidin-1-yl)-3-hydroxypiperidine-1-carboxylate (CAS 2773490-60-9) is a chemical compound with the molecular formula C15H24N2O3 and a molecular weight of 280.36 g/mol. IUPAC name: tert-butyl (3R,4S)-4-(3-ethynylazetidin-1-yl)-3-hydroxypiperidine-1-carboxylate. InChIKey: XURMJARXTUFXRL-QWHCGFSZSA-N.
| Molecular formula | C15H24N2O3 |
|---|---|
| Molecular weight | 280.36 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-(3-ethynylazetidin-1-yl)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | XURMJARXTUFXRL-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H](C1)O)N2CC(C2)C#C |
Computed by PubChem (NCBI)