Products 1246819-10-2
CAS 1246819-10-2 is the registry number for N-Methyl Trimetazidine-d8 Dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
2,2,3,3,5,5,6,6-octadeuterio-1-methyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CAS 1246819-10-2) is a chemical compound with the molecular formula C15H24N2O3 and a molecular weight of 288.41 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-methyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine. InChIKey: SQQDLCAQLUXIPC-UFBJYANTSA-N.
| Molecular formula | C15H24N2O3 |
|---|---|
| Molecular weight | 288.41 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-methyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| InChIKey | SQQDLCAQLUXIPC-UFBJYANTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])CC2=C(C(=C(C=C2)OC)OC)OC)([2H])[2H])[2H] |
Computed by PubChem (NCBI)