Products 1794760-10-3
CAS 1794760-10-3 appears in our catalog under these names: N-(Methyl-d3) Trimetazidine Dihydrochloride, 1-(Methyl-d3)-4-(2,3,4-trimethoxybenzyl)piperazine. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
1-(trideuteriomethyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CAS 1794760-10-3) is a chemical compound with the molecular formula C15H24N2O3 and a molecular weight of 283.38 g/mol. IUPAC name: 1-(trideuteriomethyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine. InChIKey: SQQDLCAQLUXIPC-FIBGUPNXSA-N.
| Molecular formula | C15H24N2O3 |
|---|---|
| Molecular weight | 283.38 g/mol |
| IUPAC name | 1-(trideuteriomethyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| InChIKey | SQQDLCAQLUXIPC-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)CC2=C(C(=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)