Products 277751-02-7

CAS 277751-02-7 is the registry number for Vildagliptin Impurity 75. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2S)-2-carbamoylpyrrolidin-1-yl]acetic acid (CAS 277751-02-7) is a chemical compound with the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. IUPAC name: 2-[(2S)-2-carbamoylpyrrolidin-1-yl]acetic acid. InChIKey: MGWRWOKPQZPYNP-YFKPBYRVSA-N.

Identity
Molecular formulaC7H12N2O3
Molecular weight172.18 g/mol
IUPAC name2-[(2S)-2-carbamoylpyrrolidin-1-yl]acetic acid
InChIKeyMGWRWOKPQZPYNP-YFKPBYRVSA-N
SMILESC1C[C@H](N(C1)CC(=O)O)C(=O)N

Computed by PubChem (NCBI)