Products 27792-97-8
CAS 27792-97-8 is the registry number for Justicidin E. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg.
5-(1,3-benzodioxol-5-yl)-6H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (CAS 27792-97-8) is a chemical compound with the molecular formula C20H12O6 and a molecular weight of 348.3 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)-6H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one. InChIKey: VSMWRDYVLPCABE-UHFFFAOYSA-N.
| Molecular formula | C20H12O6 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)-6H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| InChIKey | VSMWRDYVLPCABE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C3C=C4C(=CC3=C2C5=CC6=C(C=C5)OCO6)OCO4)C(=O)O1 |
Computed by PubChem (NCBI)