Products 78901-92-5
CAS 78901-92-5 appears in our catalog under these names: Idarubicin Impurity 3, Idarubicin Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
2-acetyl-6,7,11-trihydroxytetracene-5,12-dione (CAS 78901-92-5) is a chemical compound with the molecular formula C20H12O6 and a molecular weight of 348.3 g/mol. IUPAC name: 2-acetyl-6,7,11-trihydroxytetracene-5,12-dione. InChIKey: QQEFJERNSGGEEX-UHFFFAOYSA-N.
| Molecular formula | C20H12O6 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 2-acetyl-6,7,11-trihydroxytetracene-5,12-dione |
| InChIKey | QQEFJERNSGGEEX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C(=O)C3=C(C4=C(C=CC=C4O)C(=C3C2=O)O)O |
Computed by PubChem (NCBI)