CAS 2780364-50-1 is the registry number for IL-1β-IN-1, 99.45%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
4-methyl-2-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol (CAS 2780364-50-1) is a chemical compound with the molecular formula C22H34O2 and a molecular weight of 330.5 g/mol. IUPAC name: 4-methyl-2-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol. InChIKey: ZRYARFAQAKYULR-RBUKOAKNSA-N.
| Molecular formula | C22H34O2 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | 4-methyl-2-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| InChIKey | ZRYARFAQAKYULR-RBUKOAKNSA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1C)O)[C@@H]2C=C(CC[C@H]2C(C)C)C)O |
Computed by PubChem (NCBI)