Products 2785359-14-8
CAS 2785359-14-8 is the registry number for IMBI. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(2-isocyano-6-methylphenyl)methyl]-1H-indole (CAS 2785359-14-8) is a chemical compound with the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. IUPAC name: 3-[(2-isocyano-6-methylphenyl)methyl]-1H-indole. InChIKey: NNWWARKEVJEECU-UHFFFAOYSA-N.
| Molecular formula | C17H14N2 |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | 3-[(2-isocyano-6-methylphenyl)methyl]-1H-indole |
| InChIKey | NNWWARKEVJEECU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+]#[C-])CC2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)
Synonyms:
IMBI, orb2565971