CAS 27854-30-4 appears in our catalog under these names: 2H,2H,3H,3H-Perfluorononanoic acid, 95%, 2H,2H,3H,3H-Perfluorononanoic acid, 4,4,5,5,6,6,7,7,8,8,9,9,9–Tridecafluorononanoic acid, 4,4,5,5,6,6,7,7,8,8,9,9,9-TRIDECAFLUORO&, 4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononanoic acid, 97%, 97%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 250mg, 50mg, 100mg.
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoic acid (CAS 27854-30-4) is a chemical compound with the molecular formula C9H5F13O2 and a molecular weight of 392.11 g/mol. IUPAC name: 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoic acid. InChIKey: AAEJJSZYNKXKSW-UHFFFAOYSA-N.
| Molecular formula | C9H5F13O2 |
|---|---|
| Molecular weight | 392.11 g/mol |
| IUPAC name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoic acid |
| InChIKey | AAEJJSZYNKXKSW-UHFFFAOYSA-N |
| SMILES | C(CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C(=O)O |
Computed by PubChem (NCBI)