Products 41430-70-0
CAS 41430-70-0 is the registry number for Ethyl perfluoroheptanoate, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Ethyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate (CAS 41430-70-0) is a chemical compound with the molecular formula C9H5F13O2 and a molecular weight of 392.11 g/mol. IUPAC name: ethyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate. InChIKey: ZESCSNXJAROIJS-UHFFFAOYSA-N.
| Molecular formula | C9H5F13O2 |
|---|---|
| Molecular weight | 392.11 g/mol |
| IUPAC name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate |
| InChIKey | ZESCSNXJAROIJS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Ethyl perfluoroheptanoate, ethyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate, Heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-, ethyl ester, ZESCSNXJAROIJS-UHFFFAOYSA-N, Heptanoic acid, tridecafluoro-, ethyl ester, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid ethyl ester, Ethyl tridecafluoroheptanoate, Ethylperfluoroheptanoate, 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoro-heptanoic acid ethyl ester