CAS 27858-07-7 is the registry number for 2,2',3,3',5,5',6,6'-Octabromobiphenyl. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene (CAS 27858-07-7) is a chemical compound with the molecular formula C12H2Br8 and a molecular weight of 785.4 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene. InChIKey: NDRKXFLZSRHAJE-UHFFFAOYSA-N.
| Molecular formula | C12H2Br8 |
|---|---|
| Molecular weight | 785.4 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene |
| InChIKey | NDRKXFLZSRHAJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)