CAS 915039-12-2 is the registry number for 2,3,3′,4,4′,5,5′,6-Octabromo-1,1′-biphenyl. Offered by: TRC. Available pack sizes: 50mg.
1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenyl)benzene (CAS 915039-12-2) is a chemical compound with the molecular formula C12H2Br8 and a molecular weight of 785.4 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenyl)benzene. InChIKey: CHJHBOFOLOYRTO-UHFFFAOYSA-N.
| Molecular formula | C12H2Br8 |
|---|---|
| Molecular weight | 785.4 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenyl)benzene |
| InChIKey | CHJHBOFOLOYRTO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)